C15H26O5 — CID 71335420
2-(7,7,7-trimethoxyhept-2-ynoxy)oxane (PubChem CID 71335420) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-(7,7,7-trimethoxyhept-2-ynoxy)oxane.
| Compound Name | 2-(7,7,7-trimethoxyhept-2-ynoxy)oxane |
|---|---|
| PubChem CID | 71335420 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 2-(7,7,7-trimethoxyhept-2-ynoxy)oxane |
| SMILES | COC(CCCC#CCOC1CCCCO1)(OC)OC |
| InChI | InChI=1S/C15H26O5/c1-16-15(17-2,18-3)11-7-4-5-8-12-19-14-10-6-9-13-20-14/h14H,4,6-7,9-13H2,1-3H3 |
| InChIKey | QDIWLUIDHDSYJL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|