About acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol
acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol (PubChem CID 71335460) has the molecular formula C13H24O8
and a molecular weight of 308.33 g/mol. Its IUPAC name is acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol.
Molecular Properties
| Compound Name | acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol |
| PubChem CID | 71335460 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol |
| SMILES | CC(=O)O.CC(=O)O.OCC1CC2(CC1CO)OCCO2 |
| InChI | InChI=1S/C9H16O4.2C2H4O2/c10-5-7-3-9(4-8(7)6-11)12-1-2-13-9;2*1-2(3)4/h7-8,10-11H,1-6H2;2*1H3,(H,3,4) |
| InChIKey | RMSUTJQBTGXNIE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol?
The IUPAC name of acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol (CID 71335460) is acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol.
What is the SMILES notation for acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol?
The canonical SMILES for acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol is CC(=O)O.CC(=O)O.OCC1CC2(CC1CO)OCCO2.
What is the InChIKey of acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol?
The InChIKey is RMSUTJQBTGXNIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.2C2H4O2/c10-5-7-3-9(4-8(7)6-11)12-1-2-13-9;2*1-2(3)4/h7-8,10-11H,1-6H2;2*1H3,(H,3,4).
What are the key properties of acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol?
acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol has a molecular weight of 308.33 g/mol, XLogP of -0.08, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;[8-(hydroxymethyl)-1,4-dioxaspiro[4.4]nonan-7-yl]methanol is sourced from PubChem (CID 71335460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).