C7H3F5O3 — CID 71335543
formic acid;2,3,4,5,6-pentafluorophenol (PubChem CID 71335543) has the molecular formula C7H3F5O3 and a molecular weight of 230.09 g/mol. Its IUPAC name is formic acid;2,3,4,5,6-pentafluorophenol.
| Compound Name | formic acid;2,3,4,5,6-pentafluorophenol |
|---|---|
| PubChem CID | 71335543 |
| Molecular Formula | C7H3F5O3 |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | formic acid;2,3,4,5,6-pentafluorophenol |
| SMILES | O=CO.Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6HF5O.CH2O2/c7-1-2(8)4(10)6(12)5(11)3(1)9;2-1-3/h12H;1H,(H,2,3) |
| InChIKey | GSMNILQZPDRJHY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|