About 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol
2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol (PubChem CID 71336302) has the molecular formula C20H36N2O2
and a molecular weight of 336.52 g/mol. Its IUPAC name is 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol |
| PubChem CID | 71336302 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol |
| SMILES | CN(C)CCC(C)(C)c1cc(O)c(C(C)(C)CCN(C)C)cc1O |
| InChI | InChI=1S/C20H36N2O2/c1-19(2,9-11-21(5)6)15-13-18(24)16(14-17(15)23)20(3,4)10-12-22(7)8/h13-14,23-24H,9-12H2,1-8H3 |
| InChIKey | OOBKJLCWIKOIMH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol?
The IUPAC name of 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol (CID 71336302) is 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol.
What is the SMILES notation for 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol?
The canonical SMILES for 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol is CN(C)CCC(C)(C)c1cc(O)c(C(C)(C)CCN(C)C)cc1O.
What is the InChIKey of 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol?
The InChIKey is OOBKJLCWIKOIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2O2/c1-19(2,9-11-21(5)6)15-13-18(24)16(14-17(15)23)20(3,4)10-12-22(7)8/h13-14,23-24H,9-12H2,1-8H3.
What are the key properties of 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol?
2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol has a molecular weight of 336.52 g/mol, XLogP of 3.56, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis[4-(dimethylamino)-2-methylbutan-2-yl]benzene-1,4-diol is sourced from PubChem (CID 71336302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).