C12H20O — CID 71336497
5-butylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 71336497) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 5-butylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | 5-butylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 71336497 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 5-butylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CCCC=C1CC2CC(O)CC2C1 |
| InChI | InChI=1S/C12H20O/c1-2-3-4-9-5-10-7-12(13)8-11(10)6-9/h4,10-13H,2-3,5-8H2,1H3/b9-4- |
| InChIKey | LIGHAXJPYIUVMK-WTKPLQERSA-N |
| XLogP | 2.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|