C14H28N4O3 — CID 71336548
2-amino-N-[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]-4-methylpentanamide (PubChem CID 71336548) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-amino-N-[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 71336548 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-amino-N-[2-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-oxoethyl]-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NCC(=O)NC(CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H28N4O3/c1-8(2)5-10(15)14(21)17-7-12(19)18-11(13(16)20)6-9(3)4/h8-11H,5-7,15H2,1-4H3,(H2,16,20)(H,17,21)(H,18,19) |
| InChIKey | XFPXPLSEHYHSKM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |