About 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one
5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one (PubChem CID 71336771) has the molecular formula C6H7N5O
and a molecular weight of 165.16 g/mol. Its IUPAC name is 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one.
Analyze 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one?
The IUPAC name of 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one (CID 71336771) is 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one.
What is the SMILES notation for 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one?
The canonical SMILES for 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one is Cc1nc2n[nH]c(=O)nc2n1C.
What is the InChIKey of 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one?
The InChIKey is YMDPJPATXPBTGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5O/c1-3-7-4-5(11(3)2)8-6(12)10-9-4/h1-2H3,(H,8,10,12).
What are the key properties of 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one?
5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one has a molecular weight of 165.16 g/mol, XLogP of -0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2H-imidazo[4,5-e][1,2,4]triazin-3-one is sourced from PubChem (CID 71336771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).