About 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole
6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole (PubChem CID 713368) has the molecular formula C9H8N2S2
and a molecular weight of 208.31 g/mol. Its IUPAC name is 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
Analyze 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole (CID 713368) is 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole is c1csc(-c2cn3c(n2)SCC3)c1.
What is the InChIKey of 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
The InChIKey is SSOPPFVENQERAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S2/c1-2-8(12-4-1)7-6-11-3-5-13-9(11)10-7/h1-2,4,6H,3,5H2.
What are the key properties of 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole?
6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole has a molecular weight of 208.31 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-2-yl-2,3-dihydroimidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 713368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).