C12H11ClO3 — CID 71336819
5-(4-chlorophenyl)-3-methoxypenta-2,4-dienoic acid (PubChem CID 71336819) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-methoxypenta-2,4-dienoic acid.
| Compound Name | 5-(4-chlorophenyl)-3-methoxypenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 71336819 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-(4-chlorophenyl)-3-methoxypenta-2,4-dienoic acid |
| SMILES | COC(C=Cc1ccc(Cl)cc1)=CC(=O)O |
| InChI | InChI=1S/C12H11ClO3/c1-16-11(8-12(14)15)7-4-9-2-5-10(13)6-3-9/h2-8H,1H3,(H,14,15) |
| InChIKey | SYLCICBSBUKHRX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|