C13H21F6O4P — CID 71337011
diethyl (1,1,1,2,2,3-hexafluoro-7-methyloct-3-en-4-yl) phosphate (PubChem CID 71337011) has the molecular formula C13H21F6O4P and a molecular weight of 386.27 g/mol. Its IUPAC name is diethyl (1,1,1,2,2,3-hexafluoro-7-methyloct-3-en-4-yl) phosphate.
| Compound Name | diethyl (1,1,1,2,2,3-hexafluoro-7-methyloct-3-en-4-yl) phosphate |
|---|---|
| PubChem CID | 71337011 |
| Molecular Formula | C13H21F6O4P |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | diethyl (1,1,1,2,2,3-hexafluoro-7-methyloct-3-en-4-yl) phosphate |
| SMILES | CCOP(=O)(OCC)OC(CCC(C)C)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H21F6O4P/c1-5-21-24(20,22-6-2)23-10(8-7-9(3)4)11(14)12(15,16)13(17,18)19/h9H,5-8H2,1-4H3 |
| InChIKey | QTAXXKZZTVFQJA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|