About 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine
2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine (PubChem CID 71337252) has the molecular formula C23H15F2NS3
and a molecular weight of 439.58 g/mol. Its IUPAC name is 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine.
Molecular Properties
| Compound Name | 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine |
| PubChem CID | 71337252 |
| Molecular Formula | C23H15F2NS3 |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine |
| SMILES | Fc1nc(Sc2ccccc2)c(Sc2ccccc2)c(Sc2ccccc2)c1F |
| InChI | InChI=1S/C23H15F2NS3/c24-19-20(27-16-10-4-1-5-11-16)21(28-17-12-6-2-7-13-17)23(26-22(19)25)29-18-14-8-3-9-15-18/h1-15H |
| InChIKey | JOSRUQVEOIRNOC-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine?
The IUPAC name of 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine (CID 71337252) is 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine.
What is the SMILES notation for 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine?
The canonical SMILES for 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine is Fc1nc(Sc2ccccc2)c(Sc2ccccc2)c(Sc2ccccc2)c1F.
What is the InChIKey of 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine?
The InChIKey is JOSRUQVEOIRNOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2NS3/c24-19-20(27-16-10-4-1-5-11-16)21(28-17-12-6-2-7-13-17)23(26-22(19)25)29-18-14-8-3-9-15-18/h1-15H.
What are the key properties of 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine?
2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine has a molecular weight of 439.58 g/mol, XLogP of 7.81, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-4,5,6-tris(phenylsulfanyl)pyridine is sourced from PubChem (CID 71337252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).