About 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one
1,2-dioxaspiro[2.5]octa-4,7-dien-6-one (PubChem CID 71337471) has the molecular formula C6H4O3
and a molecular weight of 124.09 g/mol. Its IUPAC name is 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one.
Molecular Properties
| Compound Name | 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one |
| PubChem CID | 71337471 |
| Molecular Formula | C6H4O3 |
| Molecular Weight | 124.09 g/mol |
| Exact Mass | 124.02 |
| IUPAC Name | 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one |
| SMILES | O=C1C=CC2(C=C1)OO2 |
| InChI | InChI=1S/C6H4O3/c7-5-1-3-6(4-2-5)8-9-6/h1-4H |
| InChIKey | YOECOMWCIJCEFG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.09 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one?
The IUPAC name of 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one (CID 71337471) is 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one.
What is the SMILES notation for 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one?
The canonical SMILES for 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one is O=C1C=CC2(C=C1)OO2.
What is the InChIKey of 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one?
The InChIKey is YOECOMWCIJCEFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O3/c7-5-1-3-6(4-2-5)8-9-6/h1-4H.
What are the key properties of 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one?
1,2-dioxaspiro[2.5]octa-4,7-dien-6-one has a molecular weight of 124.09 g/mol, XLogP of 0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dioxaspiro[2.5]octa-4,7-dien-6-one is sourced from PubChem (CID 71337471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).