C19H41N3O2 — CID 71338115
acetic acid;1,1-dioctylguanidine (PubChem CID 71338115) has the molecular formula C19H41N3O2 and a molecular weight of 343.56 g/mol. Its IUPAC name is acetic acid;1,1-dioctylguanidine.
| Compound Name | acetic acid;1,1-dioctylguanidine |
|---|---|
| PubChem CID | 71338115 |
| Molecular Formula | C19H41N3O2 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.32 |
| IUPAC Name | acetic acid;1,1-dioctylguanidine |
| SMILES | CC(=O)O.[H]/N=C(\N)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C17H37N3.C2H4O2/c1-3-5-7-9-11-13-15-20(17(18)19)16-14-12-10-8-6-4-2;1-2(3)4/h3-16H2,1-2H3,(H3,18,19);1H3,(H,3,4) |
| InChIKey | HXZKZDGKAYBNNC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|