About tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane
tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane (PubChem CID 71339479) has the molecular formula C17H32Si
and a molecular weight of 264.53 g/mol. Its IUPAC name is tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane |
| PubChem CID | 71339479 |
| Molecular Formula | C17H32Si |
| Molecular Weight | 264.53 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane |
| SMILES | CCC=C=C(C1CCCCC1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32Si/c1-7-8-14-16(15-12-10-9-11-13-15)18(5,6)17(2,3)4/h8,15H,7,9-13H2,1-6H3 |
| InChIKey | JRQZHHUXMAPRRO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane?
The IUPAC name of tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane (CID 71339479) is tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane.
What is the SMILES notation for tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane?
The canonical SMILES for tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane is CCC=C=C(C1CCCCC1)[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane?
The InChIKey is JRQZHHUXMAPRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32Si/c1-7-8-14-16(15-12-10-9-11-13-15)18(5,6)17(2,3)4/h8,15H,7,9-13H2,1-6H3.
What are the key properties of tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane?
tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane has a molecular weight of 264.53 g/mol, XLogP of 6.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-(1-cyclohexylpenta-1,2-dienyl)-dimethylsilane is sourced from PubChem (CID 71339479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).