About 5-nitro-2,1-benzothiazole-3-diazonium
5-nitro-2,1-benzothiazole-3-diazonium (PubChem CID 71340969) has the molecular formula C7H3N4O2S+
and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-nitro-2,1-benzothiazole-3-diazonium.
Molecular Properties
| Compound Name | 5-nitro-2,1-benzothiazole-3-diazonium |
| PubChem CID | 71340969 |
| Molecular Formula | C7H3N4O2S+ |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 5-nitro-2,1-benzothiazole-3-diazonium |
| SMILES | N#[N+]c1snc2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C7H3N4O2S/c8-9-7-5-3-4(11(12)13)1-2-6(5)10-14-7/h1-3H/q+1 |
| InChIKey | MVVIKFWGXXAETP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitro-2,1-benzothiazole-3-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitro-2,1-benzothiazole-3-diazonium?
The IUPAC name of 5-nitro-2,1-benzothiazole-3-diazonium (CID 71340969) is 5-nitro-2,1-benzothiazole-3-diazonium.
What is the SMILES notation for 5-nitro-2,1-benzothiazole-3-diazonium?
The canonical SMILES for 5-nitro-2,1-benzothiazole-3-diazonium is N#[N+]c1snc2ccc([N+](=O)[O-])cc12.
What is the InChIKey of 5-nitro-2,1-benzothiazole-3-diazonium?
The InChIKey is MVVIKFWGXXAETP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N4O2S/c8-9-7-5-3-4(11(12)13)1-2-6(5)10-14-7/h1-3H/q+1.
What are the key properties of 5-nitro-2,1-benzothiazole-3-diazonium?
5-nitro-2,1-benzothiazole-3-diazonium has a molecular weight of 207.19 g/mol, XLogP of 2.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitro-2,1-benzothiazole-3-diazonium is sourced from PubChem (CID 71340969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).