C18H40N4 — CID 71341029
2,2,3,3,9,9,10,10-octamethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 71341029) has the molecular formula C18H40N4 and a molecular weight of 312.55 g/mol. Its IUPAC name is 2,2,3,3,9,9,10,10-octamethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 2,2,3,3,9,9,10,10-octamethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 71341029 |
| Molecular Formula | C18H40N4 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.33 |
| IUPAC Name | 2,2,3,3,9,9,10,10-octamethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | CC1(C)NCCCNC(C)(C)C(C)(C)NCCCNC1(C)C |
| InChI | InChI=1S/C18H40N4/c1-15(2)16(3,4)20-12-10-14-22-18(7,8)17(5,6)21-13-9-11-19-15/h19-22H,9-14H2,1-8H3 |
| InChIKey | CZFSWTPRBBSZTH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |