C10H18O7S2 — CID 71341054
1-(ethenylsulfonylmethoxy)-2-[2-(ethenylsulfonylmethoxy)ethoxy]ethane (PubChem CID 71341054) has the molecular formula C10H18O7S2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-(ethenylsulfonylmethoxy)-2-[2-(ethenylsulfonylmethoxy)ethoxy]ethane.
| Compound Name | 1-(ethenylsulfonylmethoxy)-2-[2-(ethenylsulfonylmethoxy)ethoxy]ethane |
|---|---|
| PubChem CID | 71341054 |
| Molecular Formula | C10H18O7S2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-(ethenylsulfonylmethoxy)-2-[2-(ethenylsulfonylmethoxy)ethoxy]ethane |
| SMILES | C=CS(=O)(=O)COCCOCCOCS(=O)(=O)C=C |
| InChI | InChI=1S/C10H18O7S2/c1-3-18(11,12)9-16-7-5-15-6-8-17-10-19(13,14)4-2/h3-4H,1-2,5-10H2 |
| InChIKey | LDYFAEZIWHIBEM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|