About 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene
1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene (PubChem CID 71341126) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene.
Molecular Properties
| Compound Name | 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene |
| PubChem CID | 71341126 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene |
| SMILES | Cc1ccc(C(=[N+]=[N-])C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H16N2/c1-9-5-7-10(8-6-9)11(14-13)12(2,3)4/h5-8H,1-4H3 |
| InChIKey | NSNODQAJZTXBJN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene?
The IUPAC name of 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene (CID 71341126) is 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene.
What is the SMILES notation for 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene?
The canonical SMILES for 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene is Cc1ccc(C(=[N+]=[N-])C(C)(C)C)cc1.
What is the InChIKey of 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene?
The InChIKey is NSNODQAJZTXBJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2/c1-9-5-7-10(8-6-9)11(14-13)12(2,3)4/h5-8H,1-4H3.
What are the key properties of 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene?
1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene has a molecular weight of 188.27 g/mol, XLogP of 3.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-diazo-2,2-dimethylpropyl)-4-methylbenzene is sourced from PubChem (CID 71341126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).