C20H40Si4 — CID 71341244
1,1,2,2,5,5,6,6-octaethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne (PubChem CID 71341244) has the molecular formula C20H40Si4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 1,1,2,2,5,5,6,6-octaethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne.
| Compound Name | 1,1,2,2,5,5,6,6-octaethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne |
|---|---|
| PubChem CID | 71341244 |
| Molecular Formula | C20H40Si4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 1,1,2,2,5,5,6,6-octaethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne |
| SMILES | CC[Si]1(CC)C#C[Si](CC)(CC)[Si](CC)(CC)C#C[Si]1(CC)CC |
| InChI | InChI=1S/C20H40Si4/c1-9-21(10-2)17-18-23(13-5,14-6)24(15-7,16-8)20-19-22(21,11-3)12-4/h9-16H2,1-8H3 |
| InChIKey | LQYQMXQJUXKONI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|