About 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene
1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene (PubChem CID 71341722) has the molecular formula C14H10Cl4S2
and a molecular weight of 384.18 g/mol. Its IUPAC name is 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene |
| PubChem CID | 71341722 |
| Molecular Formula | C14H10Cl4S2 |
| Molecular Weight | 384.18 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene |
| SMILES | Clc1cc(Cl)cc(CSSCc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H10Cl4S2/c15-11-1-9(2-12(16)5-11)7-19-20-8-10-3-13(17)6-14(18)4-10/h1-6H,7-8H2 |
| InChIKey | FTBNNBSSTPSHQD-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.18 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene?
The IUPAC name of 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene (CID 71341722) is 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene.
What is the SMILES notation for 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene?
The canonical SMILES for 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene is Clc1cc(Cl)cc(CSSCc2cc(Cl)cc(Cl)c2)c1.
What is the InChIKey of 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene?
The InChIKey is FTBNNBSSTPSHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl4S2/c15-11-1-9(2-12(16)5-11)7-19-20-8-10-3-13(17)6-14(18)4-10/h1-6H,7-8H2.
What are the key properties of 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene?
1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene has a molecular weight of 384.18 g/mol, XLogP of 7.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-[[(3,5-dichlorophenyl)methyldisulfanyl]methyl]benzene is sourced from PubChem (CID 71341722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).