About 2-propyl-[1,3]dioxolo[4,5-f]indazole
2-propyl-[1,3]dioxolo[4,5-f]indazole (PubChem CID 71342052) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-propyl-[1,3]dioxolo[4,5-f]indazole.
Molecular Properties
| Compound Name | 2-propyl-[1,3]dioxolo[4,5-f]indazole |
| PubChem CID | 71342052 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-propyl-[1,3]dioxolo[4,5-f]indazole |
| SMILES | CCCn1cc2cc3c(cc2n1)OCO3 |
| InChI | InChI=1S/C11H12N2O2/c1-2-3-13-6-8-4-10-11(15-7-14-10)5-9(8)12-13/h4-6H,2-3,7H2,1H3 |
| InChIKey | XHQLZYWAIPGFSG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propyl-[1,3]dioxolo[4,5-f]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-[1,3]dioxolo[4,5-f]indazole?
The IUPAC name of 2-propyl-[1,3]dioxolo[4,5-f]indazole (CID 71342052) is 2-propyl-[1,3]dioxolo[4,5-f]indazole.
What is the SMILES notation for 2-propyl-[1,3]dioxolo[4,5-f]indazole?
The canonical SMILES for 2-propyl-[1,3]dioxolo[4,5-f]indazole is CCCn1cc2cc3c(cc2n1)OCO3.
What is the InChIKey of 2-propyl-[1,3]dioxolo[4,5-f]indazole?
The InChIKey is XHQLZYWAIPGFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-2-3-13-6-8-4-10-11(15-7-14-10)5-9(8)12-13/h4-6H,2-3,7H2,1H3.
What are the key properties of 2-propyl-[1,3]dioxolo[4,5-f]indazole?
2-propyl-[1,3]dioxolo[4,5-f]indazole has a molecular weight of 204.23 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-[1,3]dioxolo[4,5-f]indazole is sourced from PubChem (CID 71342052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).