About lithium;pyridine;perchlorate
lithium;pyridine;perchlorate (PubChem CID 71342272) has the molecular formula C5H5ClLiNO4
and a molecular weight of 185.49 g/mol. Its IUPAC name is lithium;pyridine;perchlorate.
Molecular Properties
| Compound Name | lithium;pyridine;perchlorate |
| PubChem CID | 71342272 |
| Molecular Formula | C5H5ClLiNO4 |
| Molecular Weight | 185.49 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | lithium;pyridine;perchlorate |
| SMILES | [Li+].[O-][Cl+3]([O-])([O-])[O-].c1ccncc1 |
| InChI | InChI=1S/C5H5N.ClHO4.Li/c1-2-4-6-5-3-1;2-1(3,4)5;/h1-5H;(H,2,3,4,5);/q;;+1/p-1 |
| InChIKey | UMBLPEOBJVLUNO-UHFFFAOYSA-M |
| XLogP | -6.67 |
| TPSA | 105.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.49 |
| LogP ≤ 5 | -6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium;pyridine;perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;pyridine;perchlorate?
The IUPAC name of lithium;pyridine;perchlorate (CID 71342272) is lithium;pyridine;perchlorate.
What is the SMILES notation for lithium;pyridine;perchlorate?
The canonical SMILES for lithium;pyridine;perchlorate is [Li+].[O-][Cl+3]([O-])([O-])[O-].c1ccncc1.
What is the InChIKey of lithium;pyridine;perchlorate?
The InChIKey is UMBLPEOBJVLUNO-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5N.ClHO4.Li/c1-2-4-6-5-3-1;2-1(3,4)5;/h1-5H;(H,2,3,4,5);/q;;+1/p-1.
What are the key properties of lithium;pyridine;perchlorate?
lithium;pyridine;perchlorate has a molecular weight of 185.49 g/mol, XLogP of -6.67, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;pyridine;perchlorate is sourced from PubChem (CID 71342272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).