C40H80I2 — CID 71342609
1,32-diiodo-3,7,11,15,18,22,26,30-octamethyldotriacontane (PubChem CID 71342609) has the molecular formula C40H80I2 and a molecular weight of 814.89 g/mol. Its IUPAC name is 1,32-diiodo-3,7,11,15,18,22,26,30-octamethyldotriacontane.
| Compound Name | 1,32-diiodo-3,7,11,15,18,22,26,30-octamethyldotriacontane |
|---|---|
| PubChem CID | 71342609 |
| Molecular Formula | C40H80I2 |
| Molecular Weight | 814.89 g/mol |
| Exact Mass | 814.43 |
| IUPAC Name | 1,32-diiodo-3,7,11,15,18,22,26,30-octamethyldotriacontane |
| SMILES | CC(CCI)CCCC(C)CCCC(C)CCCC(C)CCC(C)CCCC(C)CCCC(C)CCCC(C)CCI |
| InChI | InChI=1S/C40H80I2/c1-33(15-9-17-35(3)21-13-25-39(7)29-31-41)19-11-23-37(5)27-28-38(6)24-12-20-34(2)16-10-18-36(4)22-14-26-40(8)30-32-42/h33-40H,9-32H2,1-8H3 |
| InChIKey | XGQXIYAVYKJTHQ-UHFFFAOYSA-N |
| XLogP | 15.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.89 |
| LogP ≤ 5 | 15.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|