About 1-silyloxyethanol
1-silyloxyethanol (PubChem CID 71342736) has the molecular formula C2H8O2Si
and a molecular weight of 92.17 g/mol. Its IUPAC name is 1-silyloxyethanol.
Molecular Properties
| Compound Name | 1-silyloxyethanol |
| PubChem CID | 71342736 |
| Molecular Formula | C2H8O2Si |
| Molecular Weight | 92.17 g/mol |
| Exact Mass | 92.03 |
| IUPAC Name | 1-silyloxyethanol |
| SMILES | CC(O)O[SiH3] |
| InChI | InChI=1S/C2H8O2Si/c1-2(3)4-5/h2-3H,1,5H3 |
| InChIKey | KNEUSYULAHGTIO-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.17 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-silyloxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-silyloxyethanol?
The IUPAC name of 1-silyloxyethanol (CID 71342736) is 1-silyloxyethanol.
What is the SMILES notation for 1-silyloxyethanol?
The canonical SMILES for 1-silyloxyethanol is CC(O)O[SiH3].
What is the InChIKey of 1-silyloxyethanol?
The InChIKey is KNEUSYULAHGTIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H8O2Si/c1-2(3)4-5/h2-3H,1,5H3.
What are the key properties of 1-silyloxyethanol?
1-silyloxyethanol has a molecular weight of 92.17 g/mol, XLogP of -1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-silyloxyethanol is sourced from PubChem (CID 71342736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).