About dinonyl octa-3,5-diynedioate
dinonyl octa-3,5-diynedioate (PubChem CID 71342855) has the molecular formula C26H42O4
and a molecular weight of 418.62 g/mol. Its IUPAC name is dinonyl octa-3,5-diynedioate.
Molecular Properties
| Compound Name | dinonyl octa-3,5-diynedioate |
| PubChem CID | 71342855 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | dinonyl octa-3,5-diynedioate |
| SMILES | CCCCCCCCCOC(=O)CC#CC#CCC(=O)OCCCCCCCCC |
| InChI | InChI=1S/C26H42O4/c1-3-5-7-9-11-15-19-23-29-25(27)21-17-13-14-18-22-26(28)30-24-20-16-12-10-8-6-4-2/h3-12,15-16,19-24H2,1-2H3 |
| InChIKey | IIPXXHFDRSLEQY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dinonyl octa-3,5-diynedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinonyl octa-3,5-diynedioate?
The IUPAC name of dinonyl octa-3,5-diynedioate (CID 71342855) is dinonyl octa-3,5-diynedioate.
What is the SMILES notation for dinonyl octa-3,5-diynedioate?
The canonical SMILES for dinonyl octa-3,5-diynedioate is CCCCCCCCCOC(=O)CC#CC#CCC(=O)OCCCCCCCCC.
What is the InChIKey of dinonyl octa-3,5-diynedioate?
The InChIKey is IIPXXHFDRSLEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42O4/c1-3-5-7-9-11-15-19-23-29-25(27)21-17-13-14-18-22-26(28)30-24-20-16-12-10-8-6-4-2/h3-12,15-16,19-24H2,1-2H3.
What are the key properties of dinonyl octa-3,5-diynedioate?
dinonyl octa-3,5-diynedioate has a molecular weight of 418.62 g/mol, XLogP of 6.36, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dinonyl octa-3,5-diynedioate is sourced from PubChem (CID 71342855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).