C11H11F7NO+ — CID 71343175
4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,2-dimethylpyridin-1-ium (PubChem CID 71343175) has the molecular formula C11H11F7NO+ and a molecular weight of 306.20 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,2-dimethylpyridin-1-ium.
| Compound Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,2-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 71343175 |
| Molecular Formula | C11H11F7NO+ |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(2,2,3,3,4,4,4-heptafluorobutoxy)-1,2-dimethylpyridin-1-ium |
| SMILES | Cc1cc(OCC(F)(F)C(F)(F)C(F)(F)F)cc[n+]1C |
| InChI | InChI=1S/C11H11F7NO/c1-7-5-8(3-4-19(7)2)20-6-9(12,13)10(14,15)11(16,17)18/h3-5H,6H2,1-2H3/q+1 |
| InChIKey | UMCBPDSMHKKJON-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|