C31H56O5 — CID 71343476
6-[3,6-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-ol (PubChem CID 71343476) has the molecular formula C31H56O5 and a molecular weight of 508.78 g/mol. Its IUPAC name is 6-[3,6-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-ol.
| Compound Name | 6-[3,6-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-ol |
|---|---|
| PubChem CID | 71343476 |
| Molecular Formula | C31H56O5 |
| Molecular Weight | 508.78 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | 6-[3,6-bis(methoxymethoxy)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-3-ol |
| SMILES | COCOC1CCC2(C)C(C1)C(OCOC)CC1C3CCC(C(C)CCC(O)C(C)C)C3(C)CCC12 |
| InChI | InChI=1S/C31H56O5/c1-20(2)28(32)11-8-21(3)24-9-10-25-23-17-29(36-19-34-7)27-16-22(35-18-33-6)12-14-31(27,5)26(23)13-15-30(24,25)4/h20-29,32H,8-19H2,1-7H3 |
| InChIKey | FCXNVSABTSPESJ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.78 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|