About 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide
1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide (PubChem CID 71343489) has the molecular formula C7H15IN2
and a molecular weight of 254.12 g/mol. Its IUPAC name is 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide.
Molecular Properties
| Compound Name | 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide |
| PubChem CID | 71343489 |
| Molecular Formula | C7H15IN2 |
| Molecular Weight | 254.12 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide |
| SMILES | CC[NH+]1C=CN(C)C1C.[I-] |
| InChI | InChI=1S/C7H14N2.HI/c1-4-9-6-5-8(3)7(9)2;/h5-7H,4H2,1-3H3;1H |
| InChIKey | ZCVLMQINUCAHNR-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.12 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide?
The IUPAC name of 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide (CID 71343489) is 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide.
What is the SMILES notation for 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide?
The canonical SMILES for 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide is CC[NH+]1C=CN(C)C1C.[I-].
What is the InChIKey of 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide?
The InChIKey is ZCVLMQINUCAHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.HI/c1-4-9-6-5-8(3)7(9)2;/h5-7H,4H2,1-3H3;1H.
What are the key properties of 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide?
1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide has a molecular weight of 254.12 g/mol, XLogP of -3.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,3-dimethyl-1,2-dihydroimidazol-1-ium iodide is sourced from PubChem (CID 71343489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).