C21H15F5OSi — CID 71343647
2,2,3,3,3-pentafluoro-1-triphenylsilylpropan-1-one (PubChem CID 71343647) has the molecular formula C21H15F5OSi and a molecular weight of 406.43 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-triphenylsilylpropan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-triphenylsilylpropan-1-one |
|---|---|
| PubChem CID | 71343647 |
| Molecular Formula | C21H15F5OSi |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-triphenylsilylpropan-1-one |
| SMILES | O=C(C(F)(F)C(F)(F)F)[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15F5OSi/c22-20(23,21(24,25)26)19(27)28(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | DRHYYTZTDONMMB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|