C22H22O3 — CID 71343652
2,6-bis(2-methoxy-5-methylphenyl)phenol (PubChem CID 71343652) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2,6-bis(2-methoxy-5-methylphenyl)phenol.
| Compound Name | 2,6-bis(2-methoxy-5-methylphenyl)phenol |
|---|---|
| PubChem CID | 71343652 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2,6-bis(2-methoxy-5-methylphenyl)phenol |
| SMILES | COc1ccc(C)cc1-c1cccc(-c2cc(C)ccc2OC)c1O |
| InChI | InChI=1S/C22H22O3/c1-14-8-10-20(24-3)18(12-14)16-6-5-7-17(22(16)23)19-13-15(2)9-11-21(19)25-4/h5-13,23H,1-4H3 |
| InChIKey | SBJPTMYFTWRTII-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |