About 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one
7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one (PubChem CID 71343758) has the molecular formula C11H14F2O3
and a molecular weight of 232.23 g/mol. Its IUPAC name is 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one.
Molecular Properties
| Compound Name | 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one |
| PubChem CID | 71343758 |
| Molecular Formula | C11H14F2O3 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one |
| SMILES | CC1(C)CC2(C=C(C(F)F)C1=O)OCCO2 |
| InChI | InChI=1S/C11H14F2O3/c1-10(2)6-11(15-3-4-16-11)5-7(8(10)14)9(12)13/h5,9H,3-4,6H2,1-2H3 |
| InChIKey | WGYDSCJMDKFUPM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one?
The IUPAC name of 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one (CID 71343758) is 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one.
What is the SMILES notation for 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one?
The canonical SMILES for 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one is CC1(C)CC2(C=C(C(F)F)C1=O)OCCO2.
What is the InChIKey of 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one?
The InChIKey is WGYDSCJMDKFUPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O3/c1-10(2)6-11(15-3-4-16-11)5-7(8(10)14)9(12)13/h5,9H,3-4,6H2,1-2H3.
What are the key properties of 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one?
7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one has a molecular weight of 232.23 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(difluoromethyl)-9,9-dimethyl-1,4-dioxaspiro[4.5]dec-6-en-8-one is sourced from PubChem (CID 71343758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).