About 2-methylimidazolidine-4,5-dione
2-methylimidazolidine-4,5-dione (PubChem CID 71344016) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-methylimidazolidine-4,5-dione.
Molecular Properties
| Compound Name | 2-methylimidazolidine-4,5-dione |
| PubChem CID | 71344016 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 2-methylimidazolidine-4,5-dione |
| SMILES | CC1NC(=O)C(=O)N1 |
| InChI | InChI=1S/C4H6N2O2/c1-2-5-3(7)4(8)6-2/h2H,1H3,(H,5,7)(H,6,8) |
| InChIKey | CTXKQFVHRPPQIO-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylimidazolidine-4,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylimidazolidine-4,5-dione?
The IUPAC name of 2-methylimidazolidine-4,5-dione (CID 71344016) is 2-methylimidazolidine-4,5-dione.
What is the SMILES notation for 2-methylimidazolidine-4,5-dione?
The canonical SMILES for 2-methylimidazolidine-4,5-dione is CC1NC(=O)C(=O)N1.
What is the InChIKey of 2-methylimidazolidine-4,5-dione?
The InChIKey is CTXKQFVHRPPQIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-2-5-3(7)4(8)6-2/h2H,1H3,(H,5,7)(H,6,8).
What are the key properties of 2-methylimidazolidine-4,5-dione?
2-methylimidazolidine-4,5-dione has a molecular weight of 114.10 g/mol, XLogP of -1.42, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylimidazolidine-4,5-dione is sourced from PubChem (CID 71344016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).