About lithium cyclopenten-1-ylbenzene
lithium cyclopenten-1-ylbenzene (PubChem CID 71344085) has the molecular formula C11H11Li
and a molecular weight of 150.15 g/mol. Its IUPAC name is lithium cyclopenten-1-ylbenzene.
Molecular Properties
| Compound Name | lithium cyclopenten-1-ylbenzene |
| PubChem CID | 71344085 |
| Molecular Formula | C11H11Li |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | lithium cyclopenten-1-ylbenzene |
| SMILES | [Li+].[c-]1ccccc1C1=CCCC1 |
| InChI | InChI=1S/C11H11.Li/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h1-3,6,8H,4-5,9H2;/q-1;+1 |
| InChIKey | UEEWLZXDJFJTBN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium cyclopenten-1-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium cyclopenten-1-ylbenzene?
The IUPAC name of lithium cyclopenten-1-ylbenzene (CID 71344085) is lithium cyclopenten-1-ylbenzene.
What is the SMILES notation for lithium cyclopenten-1-ylbenzene?
The canonical SMILES for lithium cyclopenten-1-ylbenzene is [Li+].[c-]1ccccc1C1=CCCC1.
What is the InChIKey of lithium cyclopenten-1-ylbenzene?
The InChIKey is UEEWLZXDJFJTBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11.Li/c1-2-6-10(7-3-1)11-8-4-5-9-11;/h1-3,6,8H,4-5,9H2;/q-1;+1.
What are the key properties of lithium cyclopenten-1-ylbenzene?
lithium cyclopenten-1-ylbenzene has a molecular weight of 150.15 g/mol, XLogP of 0.06, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium cyclopenten-1-ylbenzene is sourced from PubChem (CID 71344085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).