15-methylhexadec-6-enoic acid

C17H32O2 — CID 71344360

IUPAC15-methylhexadec-6-enoic acid
SMILESCC(C)CCCCCCCC=CCCCCC(=O)O
InChIInChI=1S/C17H32O2/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17(18)19/h5,7,16H,3-4,6,8-15H2,1-2H3,(H,18,19)
InChIKeyDWCHACQTXPELKE-UHFFFAOYSA-N
MW268.44 g/mol
LogP5.57
Rot. Bonds13

About 15-methylhexadec-6-enoic acid

15-methylhexadec-6-enoic acid (PubChem CID 71344360) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 15-methylhexadec-6-enoic acid.

Molecular Properties

Compound Name15-methylhexadec-6-enoic acid
PubChem CID71344360
Molecular FormulaC17H32O2
Molecular Weight268.44 g/mol
Exact Mass268.24
IUPAC Name15-methylhexadec-6-enoic acid
SMILESCC(C)CCCCCCCC=CCCCCC(=O)O
InChIInChI=1S/C17H32O2/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17(18)19/h5,7,16H,3-4,6,8-15H2,1-2H3,(H,18,19)
InChIKeyDWCHACQTXPELKE-UHFFFAOYSA-N
XLogP5.57
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms19
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500268.44
LogP ≤ 55.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 15-methylhexadec-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 15-methylhexadec-6-enoic acid?
The IUPAC name of 15-methylhexadec-6-enoic acid (CID 71344360) is 15-methylhexadec-6-enoic acid.
What is the SMILES notation for 15-methylhexadec-6-enoic acid?
The canonical SMILES for 15-methylhexadec-6-enoic acid is CC(C)CCCCCCCC=CCCCCC(=O)O.
What is the InChIKey of 15-methylhexadec-6-enoic acid?
The InChIKey is DWCHACQTXPELKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O2/c1-16(2)14-12-10-8-6-4-3-5-7-9-11-13-15-17(18)19/h5,7,16H,3-4,6,8-15H2,1-2H3,(H,18,19).
What are the key properties of 15-methylhexadec-6-enoic acid?
15-methylhexadec-6-enoic acid has a molecular weight of 268.44 g/mol, XLogP of 5.57, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 15-methylhexadec-6-enoic acid is sourced from PubChem (CID 71344360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).