C17H16F2O — CID 71344417
9-(2,6-difluorophenyl)-3,7-dimethylnona-2,4,6,8-tetraenal (PubChem CID 71344417) has the molecular formula C17H16F2O and a molecular weight of 274.31 g/mol. Its IUPAC name is 9-(2,6-difluorophenyl)-3,7-dimethylnona-2,4,6,8-tetraenal.
| Compound Name | 9-(2,6-difluorophenyl)-3,7-dimethylnona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 71344417 |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 9-(2,6-difluorophenyl)-3,7-dimethylnona-2,4,6,8-tetraenal |
| SMILES | CC(C=CC=C(C)C=Cc1c(F)cccc1F)=CC=O |
| InChI | InChI=1S/C17H16F2O/c1-13(5-3-6-14(2)11-12-20)9-10-15-16(18)7-4-8-17(15)19/h3-12H,1-2H3 |
| InChIKey | LXJVKONFTUEHRL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|