About 4-hexyl-2-methyl-1,5-dihydropyrazole
4-hexyl-2-methyl-1,5-dihydropyrazole (PubChem CID 71344545) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-hexyl-2-methyl-1,5-dihydropyrazole.
Molecular Properties
| Compound Name | 4-hexyl-2-methyl-1,5-dihydropyrazole |
| PubChem CID | 71344545 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 4-hexyl-2-methyl-1,5-dihydropyrazole |
| SMILES | CCCCCCC1=CN(C)NC1 |
| InChI | InChI=1S/C10H20N2/c1-3-4-5-6-7-10-8-11-12(2)9-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | DHIHGUZIXSSMLO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexyl-2-methyl-1,5-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexyl-2-methyl-1,5-dihydropyrazole?
The IUPAC name of 4-hexyl-2-methyl-1,5-dihydropyrazole (CID 71344545) is 4-hexyl-2-methyl-1,5-dihydropyrazole.
What is the SMILES notation for 4-hexyl-2-methyl-1,5-dihydropyrazole?
The canonical SMILES for 4-hexyl-2-methyl-1,5-dihydropyrazole is CCCCCCC1=CN(C)NC1.
What is the InChIKey of 4-hexyl-2-methyl-1,5-dihydropyrazole?
The InChIKey is DHIHGUZIXSSMLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-3-4-5-6-7-10-8-11-12(2)9-10/h9,11H,3-8H2,1-2H3.
What are the key properties of 4-hexyl-2-methyl-1,5-dihydropyrazole?
4-hexyl-2-methyl-1,5-dihydropyrazole has a molecular weight of 168.28 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexyl-2-methyl-1,5-dihydropyrazole is sourced from PubChem (CID 71344545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).