About 7,8-dihydrofluoranthene-7,8-diol
7,8-dihydrofluoranthene-7,8-diol (PubChem CID 71344733) has the molecular formula C16H12O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 7,8-dihydrofluoranthene-7,8-diol.
Molecular Properties
| Compound Name | 7,8-dihydrofluoranthene-7,8-diol |
| PubChem CID | 71344733 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 7,8-dihydrofluoranthene-7,8-diol |
| SMILES | OC1C=CC2=C(c3cccc4cccc2c34)C1O |
| InChI | InChI=1S/C16H12O2/c17-13-8-7-11-10-5-1-3-9-4-2-6-12(14(9)10)15(11)16(13)18/h1-8,13,16-18H |
| InChIKey | CRERAKOPKUUDEY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,8-dihydrofluoranthene-7,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dihydrofluoranthene-7,8-diol?
The IUPAC name of 7,8-dihydrofluoranthene-7,8-diol (CID 71344733) is 7,8-dihydrofluoranthene-7,8-diol.
What is the SMILES notation for 7,8-dihydrofluoranthene-7,8-diol?
The canonical SMILES for 7,8-dihydrofluoranthene-7,8-diol is OC1C=CC2=C(c3cccc4cccc2c34)C1O.
What is the InChIKey of 7,8-dihydrofluoranthene-7,8-diol?
The InChIKey is CRERAKOPKUUDEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O2/c17-13-8-7-11-10-5-1-3-9-4-2-6-12(14(9)10)15(11)16(13)18/h1-8,13,16-18H.
What are the key properties of 7,8-dihydrofluoranthene-7,8-diol?
7,8-dihydrofluoranthene-7,8-diol has a molecular weight of 236.27 g/mol, XLogP of 2.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dihydrofluoranthene-7,8-diol is sourced from PubChem (CID 71344733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).