C21H29F3N4O7 — CID 7134483
(1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134483) has the molecular formula C21H29F3N4O7 and a molecular weight of 506.48 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134483 |
| Molecular Formula | C21H29F3N4O7 |
| Molecular Weight | 506.48 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-4-methyl-1-oxopentan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1)C(N)=O |
| InChI | InChI=1S/C21H29F3N4O7/c1-10(2)7-13(17(25)31)27-18(32)20(34)8-14(16(30)15(29)9-20)28-19(33)26-11-3-5-12(6-4-11)35-21(22,23)24/h3-6,10,13-16,29-30,34H,7-9H2,1-2H3,(H2,25,31)(H,27,32)(H2,26,28,33)/t13-,14+,15-,16-,20+/m1/s1 |
| InChIKey | BIKFKYMMPZYPRL-YFSSQWDJSA-N |
| XLogP | 0.34 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |