About 1,2,3-trifluorocyclopropane
1,2,3-trifluorocyclopropane (PubChem CID 71344846) has the molecular formula C3H3F3
and a molecular weight of 96.05 g/mol. Its IUPAC name is 1,2,3-trifluorocyclopropane.
Molecular Properties
| Compound Name | 1,2,3-trifluorocyclopropane |
| PubChem CID | 71344846 |
| Molecular Formula | C3H3F3 |
| Molecular Weight | 96.05 g/mol |
| Exact Mass | 96.02 |
| IUPAC Name | 1,2,3-trifluorocyclopropane |
| SMILES | FC1C(F)C1F |
| InChI | InChI=1S/C3H3F3/c4-1-2(5)3(1)6/h1-3H |
| InChIKey | CUZPFBIURYEASM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.05 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,3-trifluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trifluorocyclopropane?
The IUPAC name of 1,2,3-trifluorocyclopropane (CID 71344846) is 1,2,3-trifluorocyclopropane.
What is the SMILES notation for 1,2,3-trifluorocyclopropane?
The canonical SMILES for 1,2,3-trifluorocyclopropane is FC1C(F)C1F.
What is the InChIKey of 1,2,3-trifluorocyclopropane?
The InChIKey is CUZPFBIURYEASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3F3/c4-1-2(5)3(1)6/h1-3H.
What are the key properties of 1,2,3-trifluorocyclopropane?
1,2,3-trifluorocyclopropane has a molecular weight of 96.05 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trifluorocyclopropane is sourced from PubChem (CID 71344846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).