C22H25F3N4O7S — CID 7134494
(1S,3R,4R,5S)-N-[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134494) has the molecular formula C22H25F3N4O7S and a molecular weight of 546.52 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134494 |
| Molecular Formula | C22H25F3N4O7S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-1-oxo-3-thiophen-2-ylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@H](Cc1cccs1)NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C22H25F3N4O7S/c23-22(24,25)36-12-5-3-11(4-6-12)27-20(34)29-15-9-21(35,10-16(30)17(15)31)19(33)28-14(18(26)32)8-13-2-1-7-37-13/h1-7,14-17,30-31,35H,8-10H2,(H2,26,32)(H,28,33)(H2,27,29,34)/t14-,15-,16+,17+,21-/m0/s1 |
| InChIKey | DTMSCCVJXWQUNM-YYYYNJOWSA-N |
| XLogP | 0.60 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |