About N-methyl-N-octyloctan-1-amine;perchloric acid
N-methyl-N-octyloctan-1-amine;perchloric acid (PubChem CID 71344995) has the molecular formula C17H38ClNO4
and a molecular weight of 355.95 g/mol. Its IUPAC name is N-methyl-N-octyloctan-1-amine;perchloric acid.
Molecular Properties
| Compound Name | N-methyl-N-octyloctan-1-amine;perchloric acid |
| PubChem CID | 71344995 |
| Molecular Formula | C17H38ClNO4 |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | N-methyl-N-octyloctan-1-amine;perchloric acid |
| SMILES | CCCCCCCCN(C)CCCCCCCC.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C17H37N.ClHO4/c1-4-6-8-10-12-14-16-18(3)17-15-13-11-9-7-5-2;2-1(3,4)5/h4-17H2,1-3H3;(H,2,3,4,5) |
| InChIKey | KYLPXJBNVZPWBG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-octyloctan-1-amine;perchloric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-octyloctan-1-amine;perchloric acid?
The IUPAC name of N-methyl-N-octyloctan-1-amine;perchloric acid (CID 71344995) is N-methyl-N-octyloctan-1-amine;perchloric acid.
What is the SMILES notation for N-methyl-N-octyloctan-1-amine;perchloric acid?
The canonical SMILES for N-methyl-N-octyloctan-1-amine;perchloric acid is CCCCCCCCN(C)CCCCCCCC.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of N-methyl-N-octyloctan-1-amine;perchloric acid?
The InChIKey is KYLPXJBNVZPWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N.ClHO4/c1-4-6-8-10-12-14-16-18(3)17-15-13-11-9-7-5-2;2-1(3,4)5/h4-17H2,1-3H3;(H,2,3,4,5).
What are the key properties of N-methyl-N-octyloctan-1-amine;perchloric acid?
N-methyl-N-octyloctan-1-amine;perchloric acid has a molecular weight of 355.95 g/mol, XLogP of 1.52, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-octyloctan-1-amine;perchloric acid is sourced from PubChem (CID 71344995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).