C24H27F3N4O7 — CID 7134500
(1S,3R,4R,5S)-N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134500) has the molecular formula C24H27F3N4O7 and a molecular weight of 540.50 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134500 |
| Molecular Formula | C24H27F3N4O7 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2R)-1-amino-1-oxo-3-phenylpropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H27F3N4O7/c25-24(26,27)38-15-8-6-14(7-9-15)29-22(36)31-17-11-23(37,12-18(32)19(17)33)21(35)30-16(20(28)34)10-13-4-2-1-3-5-13/h1-9,16-19,32-33,37H,10-12H2,(H2,28,34)(H,30,35)(H2,29,31,36)/t16-,17+,18-,19-,23+/m1/s1 |
| InChIKey | QDGANUPJXUKTJH-INSLWABXSA-N |
| XLogP | 0.53 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |