About 3-methyl-2,4-dihydrochromen-3-ol
3-methyl-2,4-dihydrochromen-3-ol (PubChem CID 71345229) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-methyl-2,4-dihydrochromen-3-ol.
Molecular Properties
| Compound Name | 3-methyl-2,4-dihydrochromen-3-ol |
| PubChem CID | 71345229 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-methyl-2,4-dihydrochromen-3-ol |
| SMILES | CC1(O)COc2ccccc2C1 |
| InChI | InChI=1S/C10H12O2/c1-10(11)6-8-4-2-3-5-9(8)12-7-10/h2-5,11H,6-7H2,1H3 |
| InChIKey | QPBJXWYXPAYROT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2,4-dihydrochromen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,4-dihydrochromen-3-ol?
The IUPAC name of 3-methyl-2,4-dihydrochromen-3-ol (CID 71345229) is 3-methyl-2,4-dihydrochromen-3-ol.
What is the SMILES notation for 3-methyl-2,4-dihydrochromen-3-ol?
The canonical SMILES for 3-methyl-2,4-dihydrochromen-3-ol is CC1(O)COc2ccccc2C1.
What is the InChIKey of 3-methyl-2,4-dihydrochromen-3-ol?
The InChIKey is QPBJXWYXPAYROT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-10(11)6-8-4-2-3-5-9(8)12-7-10/h2-5,11H,6-7H2,1H3.
What are the key properties of 3-methyl-2,4-dihydrochromen-3-ol?
3-methyl-2,4-dihydrochromen-3-ol has a molecular weight of 164.20 g/mol, XLogP of 1.37, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,4-dihydrochromen-3-ol is sourced from PubChem (CID 71345229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).