C25H29F3N4O8 — CID 7134525
(1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134525) has the molecular formula C25H29F3N4O8 and a molecular weight of 570.52 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134525 |
| Molecular Formula | C25H29F3N4O8 |
| Molecular Weight | 570.52 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-methoxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | COc1ccc(C[C@H](NC(=O)[C@@]2(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc3ccc(OC(F)(F)F)cc3)C2)C(N)=O)cc1 |
| InChI | InChI=1S/C25H29F3N4O8/c1-39-15-6-2-13(3-7-15)10-17(21(29)35)31-22(36)24(38)11-18(20(34)19(33)12-24)32-23(37)30-14-4-8-16(9-5-14)40-25(26,27)28/h2-9,17-20,33-34,38H,10-12H2,1H3,(H2,29,35)(H,31,36)(H2,30,32,37)/t17-,18-,19+,20+,24-/m0/s1 |
| InChIKey | LYYAYPDJHBIWMG-MAEPKYQWSA-N |
| XLogP | 0.54 |
| TPSA | 192.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |