C24H27F3N4O8 — CID 7134536
(1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide (PubChem CID 7134536) has the molecular formula C24H27F3N4O8 and a molecular weight of 556.49 g/mol. Its IUPAC name is (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide.
| Compound Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 7134536 |
| Molecular Formula | C24H27F3N4O8 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (1S,3R,4R,5S)-N-[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@]1(O)C[C@@H](O)[C@H](O)[C@@H](NC(=O)Nc2ccc(OC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H27F3N4O8/c25-24(26,27)39-15-7-3-13(4-8-15)29-22(37)31-17-10-23(38,11-18(33)19(17)34)21(36)30-16(20(28)35)9-12-1-5-14(32)6-2-12/h1-8,16-19,32-34,38H,9-11H2,(H2,28,35)(H,30,36)(H2,29,31,37)/t16-,17-,18+,19+,23-/m0/s1 |
| InChIKey | WTSSLFLYAPSDEW-AUQMSGCKSA-N |
| XLogP | 0.24 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |