About 9H-thioxanthene-1,9-diol
9H-thioxanthene-1,9-diol (PubChem CID 71345506) has the molecular formula C13H10O2S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 9H-thioxanthene-1,9-diol.
Molecular Properties
| Compound Name | 9H-thioxanthene-1,9-diol |
| PubChem CID | 71345506 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 9H-thioxanthene-1,9-diol |
| SMILES | Oc1cccc2c1C(O)c1ccccc1S2 |
| InChI | InChI=1S/C13H10O2S/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,13-15H |
| InChIKey | QRJOUKSHDFHOBN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-thioxanthene-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-thioxanthene-1,9-diol?
The IUPAC name of 9H-thioxanthene-1,9-diol (CID 71345506) is 9H-thioxanthene-1,9-diol.
What is the SMILES notation for 9H-thioxanthene-1,9-diol?
The canonical SMILES for 9H-thioxanthene-1,9-diol is Oc1cccc2c1C(O)c1ccccc1S2.
What is the InChIKey of 9H-thioxanthene-1,9-diol?
The InChIKey is QRJOUKSHDFHOBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2S/c14-9-5-3-7-11-12(9)13(15)8-4-1-2-6-10(8)16-11/h1-7,13-15H.
What are the key properties of 9H-thioxanthene-1,9-diol?
9H-thioxanthene-1,9-diol has a molecular weight of 230.29 g/mol, XLogP of 2.94, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-thioxanthene-1,9-diol is sourced from PubChem (CID 71345506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).