About 4-chlorooxolan-3-ol;formic acid
4-chlorooxolan-3-ol;formic acid (PubChem CID 71345549) has the molecular formula C5H9ClO4
and a molecular weight of 168.58 g/mol. Its IUPAC name is 4-chlorooxolan-3-ol;formic acid.
Molecular Properties
| Compound Name | 4-chlorooxolan-3-ol;formic acid |
| PubChem CID | 71345549 |
| Molecular Formula | C5H9ClO4 |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 4-chlorooxolan-3-ol;formic acid |
| SMILES | O=CO.OC1COCC1Cl |
| InChI | InChI=1S/C4H7ClO2.CH2O2/c5-3-1-7-2-4(3)6;2-1-3/h3-4,6H,1-2H2;1H,(H,2,3) |
| InChIKey | DBNZFYYPJXNXSQ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorooxolan-3-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorooxolan-3-ol;formic acid?
The IUPAC name of 4-chlorooxolan-3-ol;formic acid (CID 71345549) is 4-chlorooxolan-3-ol;formic acid.
What is the SMILES notation for 4-chlorooxolan-3-ol;formic acid?
The canonical SMILES for 4-chlorooxolan-3-ol;formic acid is O=CO.OC1COCC1Cl.
What is the InChIKey of 4-chlorooxolan-3-ol;formic acid?
The InChIKey is DBNZFYYPJXNXSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7ClO2.CH2O2/c5-3-1-7-2-4(3)6;2-1-3/h3-4,6H,1-2H2;1H,(H,2,3).
What are the key properties of 4-chlorooxolan-3-ol;formic acid?
4-chlorooxolan-3-ol;formic acid has a molecular weight of 168.58 g/mol, XLogP of -0.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorooxolan-3-ol;formic acid is sourced from PubChem (CID 71345549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).