About 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol
2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol (PubChem CID 71346024) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol |
| PubChem CID | 71346024 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol |
| SMILES | CC1(C)OC(CCO)CC(CCO)O1 |
| InChI | InChI=1S/C10H20O4/c1-10(2)13-8(3-5-11)7-9(14-10)4-6-12/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | QBSYFLOZRBYJSJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol?
The IUPAC name of 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol (CID 71346024) is 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol.
What is the SMILES notation for 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol?
The canonical SMILES for 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol is CC1(C)OC(CCO)CC(CCO)O1.
What is the InChIKey of 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol?
The InChIKey is QBSYFLOZRBYJSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O4/c1-10(2)13-8(3-5-11)7-9(14-10)4-6-12/h8-9,11-12H,3-7H2,1-2H3.
What are the key properties of 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol?
2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol has a molecular weight of 204.27 g/mol, XLogP of 0.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxan-4-yl]ethanol is sourced from PubChem (CID 71346024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).