About propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate
propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate (PubChem CID 71346114) has the molecular formula C14H20N2O6
and a molecular weight of 312.32 g/mol. Its IUPAC name is propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate |
| PubChem CID | 71346114 |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate |
| SMILES | CCOc1cc(NC(=O)OC(C)C)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C14H20N2O6/c1-5-20-12-7-10(15-14(17)22-9(3)4)11(16(18)19)8-13(12)21-6-2/h7-9H,5-6H2,1-4H3,(H,15,17) |
| InChIKey | VOQKVAQOSJRKPG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate?
The IUPAC name of propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate (CID 71346114) is propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate.
What is the SMILES notation for propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate?
The canonical SMILES for propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate is CCOc1cc(NC(=O)OC(C)C)c([N+](=O)[O-])cc1OCC.
What is the InChIKey of propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate?
The InChIKey is VOQKVAQOSJRKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O6/c1-5-20-12-7-10(15-14(17)22-9(3)4)11(16(18)19)8-13(12)21-6-2/h7-9H,5-6H2,1-4H3,(H,15,17).
What are the key properties of propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate?
propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate has a molecular weight of 312.32 g/mol, XLogP of 3.35, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(4,5-diethoxy-2-nitrophenyl)carbamate is sourced from PubChem (CID 71346114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).