C10H14O — CID 71346206
2-(cyclohexen-1-yl)-2,3-dihydrofuran (PubChem CID 71346206) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-2,3-dihydrofuran.
| Compound Name | 2-(cyclohexen-1-yl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 71346206 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 2-(cyclohexen-1-yl)-2,3-dihydrofuran |
| SMILES | C1=COC(C2=CCCCC2)C1 |
| InChI | InChI=1S/C10H14O/c1-2-5-9(6-3-1)10-7-4-8-11-10/h4-5,8,10H,1-3,6-7H2 |
| InChIKey | LWFZZBAVCMSKLB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|